C22H34O — CID 54483340
(3S,10R,13S)-10,13-dimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 54483340) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is (3S,10R,13S)-10,13-dimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13S)-10,13-dimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 54483340 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (3S,10R,13S)-10,13-dimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)C1=CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C22H34O/c1-14(2)18-7-8-19-17-6-5-15-13-16(23)9-11-21(15,3)20(17)10-12-22(18,19)4/h5,7,14,16-17,19-20,23H,6,8-13H2,1-4H3/t16-,17?,19?,20?,21-,22+/m0/s1 |
| InChIKey | XQOLYRAPERYUEJ-KZJSNDJNSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|