C25H35F3O — CID 144728945
10,13-dimethyl-17-[(E,2R)-6,6,6-trifluorohex-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 144728945) has the molecular formula C25H35F3O and a molecular weight of 408.55 g/mol. Its IUPAC name is 10,13-dimethyl-17-[(E,2R)-6,6,6-trifluorohex-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 10,13-dimethyl-17-[(E,2R)-6,6,6-trifluorohex-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 144728945 |
| Molecular Formula | C25H35F3O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 10,13-dimethyl-17-[(E,2R)-6,6,6-trifluorohex-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](/C=C/CC(F)(F)F)C1=CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H35F3O/c1-16(5-4-12-25(26,27)28)20-8-9-21-19-7-6-17-15-18(29)10-13-23(17,2)22(19)11-14-24(20,21)3/h4-6,8,16,18-19,21-22,29H,7,9-15H2,1-3H3/b5-4+/t16-,18?,19?,21?,22?,23?,24?/m1/s1 |
| InChIKey | NMVJHVCURDDDNO-ZFUIHMQESA-N |
| XLogP | 6.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|