C27H39F3O2 — CID 118699108
(3S,8R,10R,13S)-3-ethyl-10,13-dimethyl-17-[(E,2R,5S)-6,6,6-trifluoro-5-hydroxyhex-3-en-2-yl]-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 118699108) has the molecular formula C27H39F3O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is (3S,8R,10R,13S)-3-ethyl-10,13-dimethyl-17-[(E,2R,5S)-6,6,6-trifluoro-5-hydroxyhex-3-en-2-yl]-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,10R,13S)-3-ethyl-10,13-dimethyl-17-[(E,2R,5S)-6,6,6-trifluoro-5-hydroxyhex-3-en-2-yl]-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118699108 |
| Molecular Formula | C27H39F3O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (3S,8R,10R,13S)-3-ethyl-10,13-dimethyl-17-[(E,2R,5S)-6,6,6-trifluoro-5-hydroxyhex-3-en-2-yl]-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)C(=CC[C@@H]3C2CC[C@]2(C)C([C@H](C)/C=C/[C@H](O)C(F)(F)F)=CCC32)C1 |
| InChI | InChI=1S/C27H39F3O2/c1-5-26(32)15-14-24(3)18(16-26)7-8-19-21-10-9-20(25(21,4)13-12-22(19)24)17(2)6-11-23(31)27(28,29)30/h6-7,9,11,17,19,21-23,31-32H,5,8,10,12-16H2,1-4H3/b11-6+/t17-,19+,21?,22?,23+,24+,25-,26+/m1/s1 |
| InChIKey | KXBOJKIGJTVHKN-XQMNKRJUSA-N |
| XLogP | 6.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|