C26H39F3O2 — CID 171929971
(3S,8S,9S,13R,14S)-3,10,13-trimethyl-17-[(E,2R,5R)-6,6,6-trifluoro-5-hydroxyhex-3-en-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 171929971) has the molecular formula C26H39F3O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is (3S,8S,9S,13R,14S)-3,10,13-trimethyl-17-[(E,2R,5R)-6,6,6-trifluoro-5-hydroxyhex-3-en-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,13R,14S)-3,10,13-trimethyl-17-[(E,2R,5R)-6,6,6-trifluoro-5-hydroxyhex-3-en-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 171929971 |
| Molecular Formula | C26H39F3O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (3S,8S,9S,13R,14S)-3,10,13-trimethyl-17-[(E,2R,5R)-6,6,6-trifluoro-5-hydroxyhex-3-en-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](/C=C/[C@@H](O)C(F)(F)F)C1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CCC4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H39F3O2/c1-16(5-10-22(30)26(27,28)29)19-8-9-20-18-7-6-17-15-23(2,31)13-14-24(17,3)21(18)11-12-25(19,20)4/h5-6,10,16,18-22,30-31H,7-9,11-15H2,1-4H3/b10-5+/t16-,18+,19?,20+,21+,22-,23+,24?,25-/m1/s1 |
| InChIKey | DZYBKFGQUGSLGG-QIJWIHLOSA-N |
| XLogP | 6.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|