C21H34O4 — CID 177472327
(1S,2R,4aS,4bR,7S,10aR)-2-[(3R,4S)-4,5-dihydroxypent-1-en-3-yl]-2,4b-dimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthrene-1,7-diol (PubChem CID 177472327) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (1S,2R,4aS,4bR,7S,10aR)-2-[(3R,4S)-4,5-dihydroxypent-1-en-3-yl]-2,4b-dimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthrene-1,7-diol.
| Compound Name | (1S,2R,4aS,4bR,7S,10aR)-2-[(3R,4S)-4,5-dihydroxypent-1-en-3-yl]-2,4b-dimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthrene-1,7-diol |
|---|---|
| PubChem CID | 177472327 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (1S,2R,4aS,4bR,7S,10aR)-2-[(3R,4S)-4,5-dihydroxypent-1-en-3-yl]-2,4b-dimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthrene-1,7-diol |
| SMILES | C=C[C@@H]([C@H](O)CO)[C@@]1(C)CC[C@H]2[C@@H](CC=C3C[C@@H](O)CC[C@@]32C)[C@@H]1O |
| InChI | InChI=1S/C21H34O4/c1-4-16(18(24)12-22)21(3)10-8-17-15(19(21)25)6-5-13-11-14(23)7-9-20(13,17)2/h4-5,14-19,22-25H,1,6-12H2,2-3H3/t14-,15+,16-,17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | QTGQHZYIOMXTQQ-XXHSLLPRSA-N |
| XLogP | 2.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|