C23H31NO2 — CID 123165259
(8R,9S,10R,13S,14S)-10,13-dimethyl-17-(1,3-oxazol-2-ylmethyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 123165259) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(1,3-oxazol-2-ylmethyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(1,3-oxazol-2-ylmethyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 123165259 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(1,3-oxazol-2-ylmethyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CCC(O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(Cc3ncco3)=CC[C@@H]12 |
| InChI | InChI=1S/C23H31NO2/c1-22-9-7-17(25)13-15(22)3-5-18-19-6-4-16(14-21-24-11-12-26-21)23(19,2)10-8-20(18)22/h3-4,11-12,17-20,25H,5-10,13-14H2,1-2H3/t17?,18-,19-,20-,22-,23+/m0/s1 |
| InChIKey | GUCSXONTMXUHAY-BSANYDEPSA-N |
| XLogP | 5.08 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|