C28H41NO2 — CID 129091939
(3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-2-hydroxy-4-pyridin-2-ylbutan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 129091939) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-2-hydroxy-4-pyridin-2-ylbutan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-2-hydroxy-4-pyridin-2-ylbutan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 129091939 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-2-hydroxy-4-pyridin-2-ylbutan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2[C@](C)(O)CCc1ccccn1 |
| InChI | InChI=1S/C28H41NO2/c1-26-14-12-21(30)18-19(26)7-8-22-23-9-10-25(27(23,2)15-13-24(22)26)28(3,31)16-11-20-6-4-5-17-29-20/h4-7,17,21-25,30-31H,8-16,18H2,1-3H3/t21-,22-,23-,24-,25-,26-,27-,28+/m0/s1 |
| InChIKey | ZUXIXAHRDINMHT-HABHWETFSA-N |
| XLogP | 5.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|