C30H50O — CID 142587440
acetylene;(17R)-17-(2,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 142587440) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is acetylene;(17R)-17-(2,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | acetylene;(17R)-17-(2,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142587440 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | acetylene;(17R)-17-(2,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C#C.CC(C)CCCC(C)(C)[C@H]1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C28H48O.C2H2/c1-19(2)8-7-15-26(3,4)25-12-11-23-22-10-9-20-18-21(29)13-16-27(20,5)24(22)14-17-28(23,25)6;1-2/h9,19,21-25,29H,7-8,10-18H2,1-6H3;1-2H/t21?,22?,23?,24?,25-,27?,28?;/m1./s1 |
| InChIKey | RSTCOFTULREQRP-KWWKXXIMSA-N |
| XLogP | 8.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|