C31H54O3 — CID 153430103
(10R,13S)-17-[(2S,3S)-3-hydroxy-6-methyl-2-[(2-methylpropan-2-yl)oxy]heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 153430103) has the molecular formula C31H54O3 and a molecular weight of 474.77 g/mol. Its IUPAC name is (10R,13S)-17-[(2S,3S)-3-hydroxy-6-methyl-2-[(2-methylpropan-2-yl)oxy]heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10R,13S)-17-[(2S,3S)-3-hydroxy-6-methyl-2-[(2-methylpropan-2-yl)oxy]heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 153430103 |
| Molecular Formula | C31H54O3 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | (10R,13S)-17-[(2S,3S)-3-hydroxy-6-methyl-2-[(2-methylpropan-2-yl)oxy]heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CC[C@H](O)[C@@](C)(OC(C)(C)C)C1CCC2C3CC=C4CC(O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H54O3/c1-20(2)9-14-27(33)31(8,34-28(3,4)5)26-13-12-24-23-11-10-21-19-22(32)15-17-29(21,6)25(23)16-18-30(24,26)7/h10,20,22-27,32-33H,9,11-19H2,1-8H3/t22?,23?,24?,25?,26?,27-,29-,30-,31-/m0/s1 |
| InChIKey | ZXESSWMHUFWUJT-SWTMJZDISA-N |
| XLogP | 7.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|