C28H50O2 — CID 155720108
ethane;17-(1-hydroxy-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 155720108) has the molecular formula C28H50O2 and a molecular weight of 418.71 g/mol. Its IUPAC name is ethane;17-(1-hydroxy-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | ethane;17-(1-hydroxy-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 155720108 |
| Molecular Formula | C28H50O2 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.38 |
| IUPAC Name | ethane;17-(1-hydroxy-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC.CC(C)CCCC(O)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H44O2.C2H6/c1-17(2)6-5-7-24(28)23-11-10-21-20-9-8-18-16-19(27)12-14-25(18,3)22(20)13-15-26(21,23)4;1-2/h8,17,19-24,27-28H,5-7,9-16H2,1-4H3;1-2H3 |
| InChIKey | AWRZFUBIYPHZSJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|