C27H46OSn — CID 175825406
CID 175825406 (PubChem CID 175825406) has the molecular formula C27H46OSn and a molecular weight of 505.38 g/mol.
| Compound Name | CID 175825406 |
|---|---|
| PubChem CID | 175825406 |
| Molecular Formula | C27H46OSn |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | — |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C.[Sn] |
| InChI | InChI=1S/C27H46O.Sn/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5;/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3;/t19-,21+,22+,23-,24+,25+,26+,27-;/m1./s1 |
| InChIKey | IKNCAGNXHQECET-KPNWGBFJSA-N |
| XLogP | 7.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|