C27H47KO — CID 173311369
potassium;(8R,9R,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;hydride (PubChem CID 173311369) has the molecular formula C27H47KO and a molecular weight of 426.77 g/mol. Its IUPAC name is potassium;(8R,9R,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;hydride.
| Compound Name | potassium;(8R,9R,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;hydride |
|---|---|
| PubChem CID | 173311369 |
| Molecular Formula | C27H47KO |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | potassium;(8R,9R,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;hydride |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2[C@H]3CC=C4CC(O)CC[C@]4(C)[C@@H]3CC[C@@]21C.[H-].[K+] |
| InChI | InChI=1S/C27H46O.K.H/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5;;/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3;;/q;+1;-1/t19-,21?,22-,23-,24?,25-,26+,27-;;/m1../s1 |
| InChIKey | LFKPCDNVUCPYGI-KGZBFUCYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|