C26H40N2O2 — CID 155130841
(3S,8S,9S,10R,13S,14S,17S)-17-[2-hydroxy-4-(1H-pyrazol-5-yl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 155130841) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[2-hydroxy-4-(1H-pyrazol-5-yl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[2-hydroxy-4-(1H-pyrazol-5-yl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 155130841 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[2-hydroxy-4-(1H-pyrazol-5-yl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(O)(CCc1ccn[nH]1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40N2O2/c1-24-12-9-19(29)16-17(24)4-5-20-21-6-7-23(25(21,2)13-10-22(20)24)26(3,30)14-8-18-11-15-27-28-18/h4,11,15,19-23,29-30H,5-10,12-14,16H2,1-3H3,(H,27,28)/t19-,20-,21-,22-,23-,24-,25-,26?/m0/s1 |
| InChIKey | QPBVYMFIGUOGRV-BYBKDHMRSA-N |
| XLogP | 5.03 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|