C33H37NO3S — CID 102469245
(3S,8R,9S,10R,13S,14S)-17-[1-(benzenesulfonyl)indol-3-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 102469245) has the molecular formula C33H37NO3S and a molecular weight of 527.73 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-17-[1-(benzenesulfonyl)indol-3-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S)-17-[1-(benzenesulfonyl)indol-3-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 102469245 |
| Molecular Formula | C33H37NO3S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-17-[1-(benzenesulfonyl)indol-3-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cn(S(=O)(=O)c4ccccc4)c4ccccc34)=CC[C@@H]12 |
| InChI | InChI=1S/C33H37NO3S/c1-32-18-16-23(35)20-22(32)12-13-26-28-14-15-29(33(28,2)19-17-30(26)32)27-21-34(31-11-7-6-10-25(27)31)38(36,37)24-8-4-3-5-9-24/h3-12,15,21,23,26,28,30,35H,13-14,16-20H2,1-2H3/t23-,26-,28-,30-,32-,33-/m0/s1 |
| InChIKey | AHALSNIUXXYVLX-CXUFPJSCSA-N |
| XLogP | 7.20 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|