C33H35NO3S — CID 102469241
(8R,9S,10R,13S,14S)-17-[1-(benzenesulfonyl)indol-3-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 102469241) has the molecular formula C33H35NO3S and a molecular weight of 525.71 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17-[1-(benzenesulfonyl)indol-3-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-17-[1-(benzenesulfonyl)indol-3-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 102469241 |
| Molecular Formula | C33H35NO3S |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17-[1-(benzenesulfonyl)indol-3-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cn(S(=O)(=O)c4ccccc4)c4ccccc34)=CC[C@@H]12 |
| InChI | InChI=1S/C33H35NO3S/c1-32-18-16-23(35)20-22(32)12-13-26-28-14-15-29(33(28,2)19-17-30(26)32)27-21-34(31-11-7-6-10-25(27)31)38(36,37)24-8-4-3-5-9-24/h3-11,15,20-21,26,28,30H,12-14,16-19H2,1-2H3/t26-,28-,30-,32-,33-/m0/s1 |
| InChIKey | WUKJQHLWXCVVAE-ZHHBQNSFSA-N |
| XLogP | 7.40 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |