C36H44O2 — CID 124776439
(8R,9R,10R,13S,14R,17R)-10,13-dimethyl-17-[(2S)-2-methyl-5,5-diphenyloxolan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 124776439) has the molecular formula C36H44O2 and a molecular weight of 508.75 g/mol. Its IUPAC name is (8R,9R,10R,13S,14R,17R)-10,13-dimethyl-17-[(2S)-2-methyl-5,5-diphenyloxolan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14R,17R)-10,13-dimethyl-17-[(2S)-2-methyl-5,5-diphenyloxolan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 124776439 |
| Molecular Formula | C36H44O2 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | (8R,9R,10R,13S,14R,17R)-10,13-dimethyl-17-[(2S)-2-methyl-5,5-diphenyloxolan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@@H]3[C@H](CCC4=CC(=O)CC[C@@]43C)[C@H]1CC[C@H]2[C@]1(C)CCC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C36H44O2/c1-33-20-18-28(37)24-27(33)14-15-29-30-16-17-32(34(30,2)21-19-31(29)33)35(3)22-23-36(38-35,25-10-6-4-7-11-25)26-12-8-5-9-13-26/h4-13,24,29-32H,14-23H2,1-3H3/t29-,30-,31-,32-,33+,34+,35+/m1/s1 |
| InChIKey | OHAANEIIOVTZON-JNVZQMLOSA-N |
| XLogP | 8.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |