C29H36O3 — CID 53497256
(8S,9S,10R,13S,14S,17S)-17-(3-benzoyl-2-methyloxiran-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 53497256) has the molecular formula C29H36O3 and a molecular weight of 432.60 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-(3-benzoyl-2-methyloxiran-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-(3-benzoyl-2-methyloxiran-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 53497256 |
| Molecular Formula | C29H36O3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-(3-benzoyl-2-methyloxiran-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1([C@H]2CC[C@H]3[C@@H]4CCC5=CC(=O)CC[C@]5(C)[C@H]4CC[C@]23C)OC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H36O3/c1-27-15-13-20(30)17-19(27)9-10-21-22-11-12-24(28(22,2)16-14-23(21)27)29(3)26(32-29)25(31)18-7-5-4-6-8-18/h4-8,17,21-24,26H,9-16H2,1-3H3/t21-,22-,23-,24-,26?,27-,28-,29?/m0/s1 |
| InChIKey | UEXGMPWOBGMIAC-GZFPKUOWSA-N |
| XLogP | 6.17 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|