C23H30O — CID 59976962
(10R,13S)-13-ethyl-10-methyl-17-prop-1-ynyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 59976962) has the molecular formula C23H30O and a molecular weight of 322.49 g/mol. Its IUPAC name is (10R,13S)-13-ethyl-10-methyl-17-prop-1-ynyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S)-13-ethyl-10-methyl-17-prop-1-ynyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 59976962 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (10R,13S)-13-ethyl-10-methyl-17-prop-1-ynyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#CC1=CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@]12CC |
| InChI | InChI=1S/C23H30O/c1-4-6-16-8-10-21-19-9-7-17-15-18(24)11-13-22(17,3)20(19)12-14-23(16,21)5-2/h8,15,19-21H,5,7,9-14H2,1-3H3/t19?,20?,21?,22-,23+/m0/s1 |
| InChIKey | XUXILPASTDLUMU-QYKBZSJISA-N |
| XLogP | 5.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|