C25H33NO3 — CID 53234116
(3S,7R,8R,9S,10R,13S,14S)-16-methoxy-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 53234116) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is (3S,7R,8R,9S,10R,13S,14S)-16-methoxy-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3S,7R,8R,9S,10R,13S,14S)-16-methoxy-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 53234116 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (3S,7R,8R,9S,10R,13S,14S)-16-methoxy-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | COC1=C(c2cccnc2)[C@@]2(C)CC[C@H]3[C@@H]([C@@H](O)C=C4C[C@@H](O)CC[C@@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C25H33NO3/c1-24-8-6-17(27)11-16(24)12-20(28)22-18(24)7-9-25(2)19(22)13-21(29-3)23(25)15-5-4-10-26-14-15/h4-5,10,12,14,17-20,22,27-28H,6-9,11,13H2,1-3H3/t17-,18-,19-,20-,22+,24-,25-/m0/s1 |
| InChIKey | GQIDAPVDXZEZCA-FHSINVGHSA-N |
| XLogP | 4.34 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|