C26H35NO — CID 67226389
(3S,7S,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67226389) has the molecular formula C26H35NO and a molecular weight of 377.57 g/mol. Its IUPAC name is (3S,7S,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7S,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67226389 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | (3S,7S,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1=C(c2cccnc2)[C@@]2(C)CC[C@H]3[C@@H]([C@H](C)C=C4C[C@@H](O)CC[C@@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C26H35NO/c1-16-12-19-14-20(28)7-9-25(19,3)21-8-10-26(4)22(23(16)21)13-17(2)24(26)18-6-5-11-27-15-18/h5-6,11-12,15-16,20-23,28H,7-10,13-14H2,1-4H3/t16-,20+,21+,22+,23-,25+,26+/m1/s1 |
| InChIKey | UDQLAATUBWSSQA-YXGSBORJSA-N |
| XLogP | 6.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|