C25H34O2 — CID 67226057
(8R,9R,10R,13S,14S)-17-(furan-2-yl)-7,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67226057) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-(furan-2-yl)-7,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9R,10R,13S,14S)-17-(furan-2-yl)-7,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67226057 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-(furan-2-yl)-7,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1=C(c2ccco2)[C@@]2(C)CC[C@@H]3[C@@H](C(C)C=C4CC(O)CC[C@@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C25H34O2/c1-15-12-17-14-18(26)7-9-24(17,3)19-8-10-25(4)20(22(15)19)13-16(2)23(25)21-6-5-11-27-21/h5-6,11-12,15,18-20,22,26H,7-10,13-14H2,1-4H3/t15?,18?,19-,20+,22-,24+,25+/m1/s1 |
| InChIKey | AILWDRWYKKNBAC-BPAZLWAGSA-N |
| XLogP | 6.23 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|