C27H42O — CID 67224877
(3S,7S,8R,9S,10R,13S,14S)-17-cyclohexyl-7,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67224877) has the molecular formula C27H42O and a molecular weight of 382.63 g/mol. Its IUPAC name is (3S,7S,8R,9S,10R,13S,14S)-17-cyclohexyl-7,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7S,8R,9S,10R,13S,14S)-17-cyclohexyl-7,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67224877 |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | (3S,7S,8R,9S,10R,13S,14S)-17-cyclohexyl-7,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1=C(C2CCCCC2)[C@@]2(C)CC[C@H]3[C@@H]([C@H](C)C=C4C[C@@H](O)CC[C@@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C27H42O/c1-17-14-20-16-21(28)10-12-26(20,3)22-11-13-27(4)23(24(17)22)15-18(2)25(27)19-8-6-5-7-9-19/h14,17,19,21-24,28H,5-13,15-16H2,1-4H3/t17-,21+,22+,23+,24-,26+,27+/m1/s1 |
| InChIKey | KRRFWBLIJMXJOC-JDHVKNQUSA-N |
| XLogP | 7.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|