C23H32N2O2 — CID 67226065
(3S,7R,8R,9S,10R,13S,14S)-17-imidazol-1-yl-7,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 67226065) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (3S,7R,8R,9S,10R,13S,14S)-17-imidazol-1-yl-7,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (3S,7R,8R,9S,10R,13S,14S)-17-imidazol-1-yl-7,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 67226065 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | (3S,7R,8R,9S,10R,13S,14S)-17-imidazol-1-yl-7,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C[C@H]1C=C2C[C@@H](O)CC[C@]2(C)[C@H]2CC[C@]3(C)C(n4ccnc4)=C(O)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C23H32N2O2/c1-14-10-15-11-16(26)4-6-22(15,2)17-5-7-23(3)18(20(14)17)12-19(27)21(23)25-9-8-24-13-25/h8-10,13-14,16-18,20,26-27H,4-7,11-12H2,1-3H3/t14-,16-,17-,18-,20+,22-,23-/m0/s1 |
| InChIKey | WWJGJRULBYPQTF-PACFARPASA-N |
| XLogP | 4.79 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|