C23H31NO3 — CID 67225242
(8R,9R,10R,13S,14S)-7,10,13-trimethyl-17-(1,3-oxazol-5-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 67225242) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-7,10,13-trimethyl-17-(1,3-oxazol-5-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (8R,9R,10R,13S,14S)-7,10,13-trimethyl-17-(1,3-oxazol-5-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 67225242 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (8R,9R,10R,13S,14S)-7,10,13-trimethyl-17-(1,3-oxazol-5-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | CC1C=C2CC(O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(c4cnco4)=C(O)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C23H31NO3/c1-13-8-14-9-15(25)4-6-22(14,2)16-5-7-23(3)17(20(13)16)10-18(26)21(23)19-11-24-12-27-19/h8,11-13,15-17,20,25-26H,4-7,9-10H2,1-3H3/t13?,15?,16-,17+,20-,22+,23+/m1/s1 |
| InChIKey | URTOUYAUYWAGQQ-IISUYLETSA-N |
| XLogP | 5.12 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|