C25H36N2O — CID 67225412
(3S,7R,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-(2H-pyrimidin-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67225412) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is (3S,7R,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-(2H-pyrimidin-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7R,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-(2H-pyrimidin-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67225412 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | (3S,7R,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-(2H-pyrimidin-1-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1=C(N2C=CC=NC2)[C@@]2(C)CC[C@H]3[C@@H]([C@@H](C)C=C4C[C@@H](O)CC[C@@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C25H36N2O/c1-16-12-18-14-19(28)6-8-24(18,3)20-7-9-25(4)21(22(16)20)13-17(2)23(25)27-11-5-10-26-15-27/h5,10-12,16,19-22,28H,6-9,13-15H2,1-4H3/t16-,19-,20-,21-,22+,24-,25-/m0/s1 |
| InChIKey | TUSJDBMIIRIYEM-JJXJKSRTSA-N |
| XLogP | 5.30 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|