C26H42N2O — CID 67226154
(3S,7R,8R,9S,10R,13S,14S)-7-ethyl-10,13,16-trimethyl-17-piperazin-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67226154) has the molecular formula C26H42N2O and a molecular weight of 398.64 g/mol. Its IUPAC name is (3S,7R,8R,9S,10R,13S,14S)-7-ethyl-10,13,16-trimethyl-17-piperazin-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7R,8R,9S,10R,13S,14S)-7-ethyl-10,13,16-trimethyl-17-piperazin-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67226154 |
| Molecular Formula | C26H42N2O |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | (3S,7R,8R,9S,10R,13S,14S)-7-ethyl-10,13,16-trimethyl-17-piperazin-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@H]1C=C2C[C@@H](O)CC[C@]2(C)[C@H]2CC[C@]3(C)C(N4CCNCC4)=C(C)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C26H42N2O/c1-5-18-15-19-16-20(29)6-8-25(19,3)21-7-9-26(4)22(23(18)21)14-17(2)24(26)28-12-10-27-11-13-28/h15,18,20-23,27,29H,5-14,16H2,1-4H3/t18-,20-,21-,22-,23+,25-,26-/m0/s1 |
| InChIKey | HJMXTFUIFXRYPP-SOPGZXPBSA-N |
| XLogP | 4.74 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|