C26H36OS — CID 123429029
3-[(8R,9R,10R,13S,14S)-7-ethyl-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]thiophene (PubChem CID 123429029) has the molecular formula C26H36OS and a molecular weight of 396.64 g/mol. Its IUPAC name is 3-[(8R,9R,10R,13S,14S)-7-ethyl-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]thiophene.
| Compound Name | 3-[(8R,9R,10R,13S,14S)-7-ethyl-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]thiophene |
|---|---|
| PubChem CID | 123429029 |
| Molecular Formula | C26H36OS |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 3-[(8R,9R,10R,13S,14S)-7-ethyl-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]thiophene |
| SMILES | CCC1C=C2CC(OC)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(c4ccsc4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C26H36OS/c1-5-17-14-19-15-20(27-4)8-11-25(19,2)23-9-12-26(3)21(18-10-13-28-16-18)6-7-22(26)24(17)23/h6,10,13-14,16-17,20,22-24H,5,7-9,11-12,15H2,1-4H3/t17?,20?,22-,23+,24-,25-,26+/m0/s1 |
| InChIKey | PLZIGPACAZANMD-OPZZOTFBSA-N |
| XLogP | 7.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|