C22H34O4 — CID 59475285
(10R,13S)-3-methoxy-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-7-ol (PubChem CID 59475285) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (10R,13S)-3-methoxy-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-7-ol.
| Compound Name | (10R,13S)-3-methoxy-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-7-ol |
|---|---|
| PubChem CID | 59475285 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (10R,13S)-3-methoxy-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-7-ol |
| SMILES | COC1CC[C@@]2(C)C(=CC(O)C3C2CC[C@@]2(C)C3CCC23OCCO3)C1 |
| InChI | InChI=1S/C22H34O4/c1-20-7-4-15(24-3)12-14(20)13-18(23)19-16(20)5-8-21(2)17(19)6-9-22(21)25-10-11-26-22/h13,15-19,23H,4-12H2,1-3H3/t15?,16?,17?,18?,19?,20-,21-/m0/s1 |
| InChIKey | CNWLQZKLBLIKII-WRZXQAEKSA-N |
| XLogP | 3.68 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|