C23H30O6 — CID 161483360
[(3S,10R,13S,17R)-17-ethynyl-7,17-dihydroxy-10,13-dimethyl-16-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] methyl carbonate (PubChem CID 161483360) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is [(3S,10R,13S,17R)-17-ethynyl-7,17-dihydroxy-10,13-dimethyl-16-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] methyl carbonate.
| Compound Name | [(3S,10R,13S,17R)-17-ethynyl-7,17-dihydroxy-10,13-dimethyl-16-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 161483360 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [(3S,10R,13S,17R)-17-ethynyl-7,17-dihydroxy-10,13-dimethyl-16-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] methyl carbonate |
| SMILES | C#C[C@]1(O)C(=O)CC2C3C(O)C=C4C[C@@H](OC(=O)OC)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C23H30O6/c1-5-23(27)18(25)12-16-19-15(7-9-22(16,23)3)21(2)8-6-14(29-20(26)28-4)10-13(21)11-17(19)24/h1,11,14-17,19,24,27H,6-10,12H2,2-4H3/t14-,15?,16?,17?,19?,21-,22-,23-/m0/s1 |
| InChIKey | SZQPYZXMJGCURG-GZTMVSASSA-N |
| XLogP | 2.61 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|