C23H32O7 — CID 91432081
(3S,7R,10R,13S,17R)-17-ethynyl-7,16,17-trihydroxy-3-(methoxymethylperoxy)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,16-decahydro-1H-cyclopenta[a]phenanthren-15-one (PubChem CID 91432081) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is (3S,7R,10R,13S,17R)-17-ethynyl-7,16,17-trihydroxy-3-(methoxymethylperoxy)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,16-decahydro-1H-cyclopenta[a]phenanthren-15-one.
| Compound Name | (3S,7R,10R,13S,17R)-17-ethynyl-7,16,17-trihydroxy-3-(methoxymethylperoxy)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,16-decahydro-1H-cyclopenta[a]phenanthren-15-one |
|---|---|
| PubChem CID | 91432081 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (3S,7R,10R,13S,17R)-17-ethynyl-7,16,17-trihydroxy-3-(methoxymethylperoxy)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,16-decahydro-1H-cyclopenta[a]phenanthren-15-one |
| SMILES | C#C[C@]1(O)C(O)C(=O)C2C3C(O)C=C4C[C@@H](OOCOC)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C23H32O7/c1-5-23(27)20(26)19(25)18-17-15(7-9-22(18,23)3)21(2)8-6-14(30-29-12-28-4)10-13(21)11-16(17)24/h1,11,14-18,20,24,26-27H,6-10,12H2,2-4H3/t14-,15?,16?,17?,18?,20?,21-,22-,23-/m0/s1 |
| InChIKey | BLTWMNHXBCGRLL-SNXODIBUSA-N |
| XLogP | 1.35 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|