C23H34O4 — CID 67987309
(3S,7R,10R,13S,17S)-7,17-dihydroxy-10,13,17-trimethyl-3-prop-1-en-2-yloxy-2,3,4,7,8,9,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 67987309) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (3S,7R,10R,13S,17S)-7,17-dihydroxy-10,13,17-trimethyl-3-prop-1-en-2-yloxy-2,3,4,7,8,9,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (3S,7R,10R,13S,17S)-7,17-dihydroxy-10,13,17-trimethyl-3-prop-1-en-2-yloxy-2,3,4,7,8,9,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 67987309 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (3S,7R,10R,13S,17S)-7,17-dihydroxy-10,13,17-trimethyl-3-prop-1-en-2-yloxy-2,3,4,7,8,9,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | C=C(C)O[C@H]1CC[C@@]2(C)C(=CC(O)C3C2C(=O)C[C@@]2(C)C3CC[C@]2(C)O)C1 |
| InChI | InChI=1S/C23H34O4/c1-13(2)27-15-6-8-21(3)14(10-15)11-17(24)19-16-7-9-23(5,26)22(16,4)12-18(25)20(19)21/h11,15-17,19-20,24,26H,1,6-10,12H2,2-5H3/t15-,16?,17?,19?,20?,21-,22-,23-/m0/s1 |
| InChIKey | HIDRYPAQXVNVQA-WISPXVGCSA-N |
| XLogP | 3.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|