C33H58O4Si2 — CID 59742836
(3S,7R,10R,13S,16R,17S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethynyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-16,17-diol (PubChem CID 59742836) has the molecular formula C33H58O4Si2 and a molecular weight of 575.00 g/mol. Its IUPAC name is (3S,7R,10R,13S,16R,17S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethynyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-16,17-diol.
| Compound Name | (3S,7R,10R,13S,16R,17S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethynyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-16,17-diol |
|---|---|
| PubChem CID | 59742836 |
| Molecular Formula | C33H58O4Si2 |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | (3S,7R,10R,13S,16R,17S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethynyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-16,17-diol |
| SMILES | C#C[C@@]1(O)[C@H](O)CC2C3C(O[Si](C)(C)C(C)(C)C)C=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C33H58O4Si2/c1-14-33(35)27(34)21-25-28-24(16-18-32(25,33)9)31(8)17-15-23(36-38(10,11)29(2,3)4)19-22(31)20-26(28)37-39(12,13)30(5,6)7/h1,20,23-28,34-35H,15-19,21H2,2-13H3/t23-,24?,25?,26?,27+,28?,31-,32-,33+/m0/s1 |
| InChIKey | WMBJRCQKDNSZSU-GVNPPCEOSA-N |
| XLogP | 7.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|