C21H29ClO5 — CID 69248063
(2S,3S,7R,8R,9S,10R,13S,14S,16R,17S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-2,3,7,16,17-pentol (PubChem CID 69248063) has the molecular formula C21H29ClO5 and a molecular weight of 396.91 g/mol. Its IUPAC name is (2S,3S,7R,8R,9S,10R,13S,14S,16R,17S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-2,3,7,16,17-pentol.
| Compound Name | (2S,3S,7R,8R,9S,10R,13S,14S,16R,17S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-2,3,7,16,17-pentol |
|---|---|
| PubChem CID | 69248063 |
| Molecular Formula | C21H29ClO5 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (2S,3S,7R,8R,9S,10R,13S,14S,16R,17S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-2,3,7,16,17-pentol |
| SMILES | C[C@]12C[C@H](O)[C@@H](O)CC1=C[C@H](O)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1C[C@@H](O)[C@@]2(O)C#CCl |
| InChI | InChI=1S/C21H29ClO5/c1-19-10-16(25)14(23)7-11(19)8-15(24)18-12(19)3-4-20(2)13(18)9-17(26)21(20,27)5-6-22/h8,12-18,23-27H,3-4,7,9-10H2,1-2H3/t12-,13-,14-,15-,16-,17+,18+,19-,20-,21-/m0/s1 |
| InChIKey | RLXJXJNVSGPRNL-ISKWUEMLSA-N |
| XLogP | 1.15 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|