C19H30O4 — CID 69250055
(2R,3R,7R,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3,7,17-tetrol (PubChem CID 69250055) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is (2R,3R,7R,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3,7,17-tetrol.
| Compound Name | (2R,3R,7R,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3,7,17-tetrol |
|---|---|
| PubChem CID | 69250055 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (2R,3R,7R,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3,7,17-tetrol |
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@@H](O)C=C4C[C@@H](O)[C@H](O)C[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C19H30O4/c1-18-6-5-12-17(11(18)3-4-16(18)23)14(21)8-10-7-13(20)15(22)9-19(10,12)2/h8,11-17,20-23H,3-7,9H2,1-2H3/t11-,12-,13+,14-,15+,16-,17-,18-,19-/m0/s1 |
| InChIKey | IFZGJFWRKLGZJN-HBJJVZSZSA-N |
| XLogP | 1.61 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|