C21H29ClO4 — CID 69250536
(8R,9R,10R,13S,14S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-2,3,7,17-tetrol (PubChem CID 69250536) has the molecular formula C21H29ClO4 and a molecular weight of 380.91 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-2,3,7,17-tetrol.
| Compound Name | (8R,9R,10R,13S,14S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-2,3,7,17-tetrol |
|---|---|
| PubChem CID | 69250536 |
| Molecular Formula | C21H29ClO4 |
| Molecular Weight | 380.91 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-2,3,7,17-tetrol |
| SMILES | C[C@]12CC(O)C(O)CC1=CC(O)[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(O)C#CCl |
| InChI | InChI=1S/C21H29ClO4/c1-19-11-17(25)15(23)9-12(19)10-16(24)18-13(19)3-5-20(2)14(18)4-6-21(20,26)7-8-22/h10,13-18,23-26H,3-6,9,11H2,1-2H3/t13-,14+,15?,16?,17?,18-,19+,20+,21?/m1/s1 |
| InChIKey | CWGIIUQPNLKTQC-ZWTOCDHOSA-N |
| XLogP | 2.18 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.91 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|