C19H29ClO3 — CID 90733838
(8R,9R,10R,13S,14S)-17-chloro-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-triol (PubChem CID 90733838) has the molecular formula C19H29ClO3 and a molecular weight of 340.89 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-chloro-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-triol.
| Compound Name | (8R,9R,10R,13S,14S)-17-chloro-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-triol |
|---|---|
| PubChem CID | 90733838 |
| Molecular Formula | C19H29ClO3 |
| Molecular Weight | 340.89 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-chloro-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-triol |
| SMILES | C[C@]12CCC(O)C=C1CC(O)[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(O)Cl |
| InChI | InChI=1S/C19H29ClO3/c1-17-6-3-12(21)9-11(17)10-15(22)16-13(17)4-7-18(2)14(16)5-8-19(18,20)23/h9,12-16,21-23H,3-8,10H2,1-2H3/t12?,13-,14+,15?,16-,17+,18+,19?/m1/s1 |
| InChIKey | IUXCXLPKSXLYRC-LWOAGIHKSA-N |
| XLogP | 3.21 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|