C19H30O3S — CID 157142449
(2S,5S,13R,14S,15S)-2,13,15-trimethyl-17-thiatetracyclo[8.7.0.02,7.011,15]heptadec-6-ene-5,9,14-triol (PubChem CID 157142449) has the molecular formula C19H30O3S and a molecular weight of 338.51 g/mol. Its IUPAC name is (2S,5S,13R,14S,15S)-2,13,15-trimethyl-17-thiatetracyclo[8.7.0.02,7.011,15]heptadec-6-ene-5,9,14-triol.
| Compound Name | (2S,5S,13R,14S,15S)-2,13,15-trimethyl-17-thiatetracyclo[8.7.0.02,7.011,15]heptadec-6-ene-5,9,14-triol |
|---|---|
| PubChem CID | 157142449 |
| Molecular Formula | C19H30O3S |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (2S,5S,13R,14S,15S)-2,13,15-trimethyl-17-thiatetracyclo[8.7.0.02,7.011,15]heptadec-6-ene-5,9,14-triol |
| SMILES | C[C@@H]1CC2C3C(O)CC4=C[C@@H](O)CC[C@]4(C)C3SC[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C19H30O3S/c1-10-6-13-15-14(21)8-11-7-12(20)4-5-18(11,2)17(15)23-9-19(13,3)16(10)22/h7,10,12-17,20-22H,4-6,8-9H2,1-3H3/t10-,12+,13?,14?,15?,16+,17?,18+,19+/m1/s1 |
| InChIKey | CTZHTSAVYNVJDB-BSMIDLQVSA-N |
| XLogP | 2.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|