C22H36O2S2 — CID 18645954
(3R,8S,9S,10S,13S,14S,16S,17S)-10-[(ethyldisulfanyl)methyl]-13,16-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 18645954) has the molecular formula C22H36O2S2 and a molecular weight of 396.66 g/mol. Its IUPAC name is (3R,8S,9S,10S,13S,14S,16S,17S)-10-[(ethyldisulfanyl)methyl]-13,16-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3R,8S,9S,10S,13S,14S,16S,17S)-10-[(ethyldisulfanyl)methyl]-13,16-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 18645954 |
| Molecular Formula | C22H36O2S2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (3R,8S,9S,10S,13S,14S,16S,17S)-10-[(ethyldisulfanyl)methyl]-13,16-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCSSC[C@]12CC[C@@H](O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)[C@@H](C)C[C@@H]12 |
| InChI | InChI=1S/C22H36O2S2/c1-4-25-26-13-22-10-7-16(23)12-15(22)5-6-17-18(22)8-9-21(3)19(17)11-14(2)20(21)24/h12,14,16-20,23-24H,4-11,13H2,1-3H3/t14-,16+,17+,18-,19-,20-,21-,22+/m0/s1 |
| InChIKey | MBTMSORRZMLHTJ-HTTQKGEDSA-N |
| XLogP | 5.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|