C23H36O2 — CID 10132282
(3S,8S,9S,10S,13S,14S,17R)-13-methyl-17-pent-1-en-2-yl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,10-diol (PubChem CID 10132282) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (3S,8S,9S,10S,13S,14S,17R)-13-methyl-17-pent-1-en-2-yl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,10-diol.
| Compound Name | (3S,8S,9S,10S,13S,14S,17R)-13-methyl-17-pent-1-en-2-yl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,10-diol |
|---|---|
| PubChem CID | 10132282 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (3S,8S,9S,10S,13S,14S,17R)-13-methyl-17-pent-1-en-2-yl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,10-diol |
| SMILES | C=C(CCC)[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@@H](O)CC[C@]4(O)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H36O2/c1-4-5-15(2)19-8-9-20-18-7-6-16-14-17(24)10-13-23(16,25)21(18)11-12-22(19,20)3/h14,17-21,24-25H,2,4-13H2,1,3H3/t17-,18-,19+,20-,21-,22+,23+/m0/s1 |
| InChIKey | QYNATEBZKJUCFA-XCXHLKQJSA-N |
| XLogP | 5.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|