C19H31NO2 — CID 162024402
(2S,5S,14S,15R)-2,14,15-trimethyl-17-azatetracyclo[8.7.0.02,7.011,15]heptadec-6-ene-5,9-diol (PubChem CID 162024402) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (2S,5S,14S,15R)-2,14,15-trimethyl-17-azatetracyclo[8.7.0.02,7.011,15]heptadec-6-ene-5,9-diol.
| Compound Name | (2S,5S,14S,15R)-2,14,15-trimethyl-17-azatetracyclo[8.7.0.02,7.011,15]heptadec-6-ene-5,9-diol |
|---|---|
| PubChem CID | 162024402 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (2S,5S,14S,15R)-2,14,15-trimethyl-17-azatetracyclo[8.7.0.02,7.011,15]heptadec-6-ene-5,9-diol |
| SMILES | C[C@H]1CCC2C3C(O)CC4=C[C@@H](O)CC[C@]4(C)C3NC[C@@]21C |
| InChI | InChI=1S/C19H31NO2/c1-11-4-5-14-16-15(22)9-12-8-13(21)6-7-18(12,2)17(16)20-10-19(11,14)3/h8,11,13-17,20-22H,4-7,9-10H2,1-3H3/t11-,13-,14?,15?,16?,17?,18-,19+/m0/s1 |
| InChIKey | RDMOIYYQSCBQSV-ZGCLUXRNSA-N |
| XLogP | 2.48 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|