C19H27ClO2 — CID 56997684
(8R,9R,10R,13S,14S)-7-chloro-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 56997684) has the molecular formula C19H27ClO2 and a molecular weight of 322.88 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-7-chloro-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9R,10R,13S,14S)-7-chloro-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 56997684 |
| Molecular Formula | C19H27ClO2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (8R,9R,10R,13S,14S)-7-chloro-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(O)CC1=CC(Cl)[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H27ClO2/c1-18-7-5-12(21)9-11(18)10-15(20)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-15,17,21H,3-9H2,1-2H3/t12?,13-,14+,15?,17-,18-,19-/m0/s1 |
| InChIKey | DBPXSHRKKLTXDK-YDYOXOKUSA-N |
| XLogP | 4.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|