C19H27NO3 — CID 173236377
(8R,9R,10R,13S,14S)-3-hydroxy-7-hydroxyimino-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 173236377) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-3-hydroxy-7-hydroxyimino-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9R,10R,13S,14S)-3-hydroxy-7-hydroxyimino-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 173236377 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (8R,9R,10R,13S,14S)-3-hydroxy-7-hydroxyimino-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(O)CC1=CC(=NO)[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H27NO3/c1-18-7-5-12(21)9-11(18)10-15(20-23)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-14,17,21,23H,3-9H2,1-2H3/t12?,13-,14+,17-,18-,19-/m0/s1 |
| InChIKey | BNMNSEHDOZJCFM-MBKAGASGSA-N |
| XLogP | 3.32 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|