C19H28O3 — CID 71216162
(3S,7R,10R)-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 71216162) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (3S,7R,10R)-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,7R,10R)-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 71216162 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (3S,7R,10R)-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3C(C(O)C=C4C[C@@H](O)CC[C@@]43C)C1CCC2=O |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-15,17,20-21H,3-9H2,1-2H3/t12-,13?,14?,15?,17?,18-,19?/m0/s1 |
| InChIKey | OLPSAOWBSPXZEA-ZMHFUNKUSA-N |
| XLogP | 2.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|