C21H30O4 — CID 58595787
(3S,7R,8S,9S,10R,11R,13S)-17-ethynyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,11,17-tetrol (PubChem CID 58595787) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (3S,7R,8S,9S,10R,11R,13S)-17-ethynyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,11,17-tetrol.
| Compound Name | (3S,7R,8S,9S,10R,11R,13S)-17-ethynyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,11,17-tetrol |
|---|---|
| PubChem CID | 58595787 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (3S,7R,8S,9S,10R,11R,13S)-17-ethynyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,11,17-tetrol |
| SMILES | C#CC1(O)CCC2[C@H]3[C@H]([C@H](O)C[C@@]21C)[C@@]1(C)CC[C@H](O)CC1=C[C@@H]3O |
| InChI | InChI=1S/C21H30O4/c1-4-21(25)8-6-14-17-15(23)10-12-9-13(22)5-7-19(12,2)18(17)16(24)11-20(14,21)3/h1,10,13-18,22-25H,5-9,11H2,2-3H3/t13-,14?,15-,16+,17+,18-,19-,20-,21?/m0/s1 |
| InChIKey | KQFMYJMAZQVTBC-ZHXKHWJMSA-N |
| XLogP | 1.62 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|