C22H31ClO2 — CID 5105189
17-(2-chloroethynyl)-17-hydroxy-2,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 5105189) has the molecular formula C22H31ClO2 and a molecular weight of 362.94 g/mol. Its IUPAC name is 17-(2-chloroethynyl)-17-hydroxy-2,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(2-chloroethynyl)-17-hydroxy-2,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 5105189 |
| Molecular Formula | C22H31ClO2 |
| Molecular Weight | 362.94 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 17-(2-chloroethynyl)-17-hydroxy-2,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1CC2(C)C(CCC3C2CCC2(C)C3CCC2(O)C#CCl)CC1=O |
| InChI | InChI=1S/C22H31ClO2/c1-14-13-20(2)15(12-19(14)24)4-5-16-17(20)6-8-21(3)18(16)7-9-22(21,25)10-11-23/h14-18,25H,4-9,12-13H2,1-3H3 |
| InChIKey | CPVGZDNKHUQUON-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|