C21H34O3 — CID 125035920
(2R,5S,8R,9R,10S,11R,13R,14S,17S)-11,17-dihydroxy-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 125035920) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (2R,5S,8R,9R,10S,11R,13R,14S,17S)-11,17-dihydroxy-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (2R,5S,8R,9R,10S,11R,13R,14S,17S)-11,17-dihydroxy-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 125035920 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (2R,5S,8R,9R,10S,11R,13R,14S,17S)-11,17-dihydroxy-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C[C@@]2(C)[C@@H](CC[C@H]3[C@H]2[C@H](O)C[C@]2(C)[C@H]3CC[C@]2(C)O)CC1=O |
| InChI | InChI=1S/C21H34O3/c1-12-10-19(2)13(9-16(12)22)5-6-14-15-7-8-21(4,24)20(15,3)11-17(23)18(14)19/h12-15,17-18,23-24H,5-11H2,1-4H3/t12-,13+,14-,15+,17-,18+,19+,20-,21+/m1/s1 |
| InChIKey | SFKLNBOMRUIZOU-PDEDQIIKSA-N |
| XLogP | 3.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |