C20H32O4 — CID 21015402
1,2,17-trihydroxy-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 21015402) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 1,2,17-trihydroxy-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 1,2,17-trihydroxy-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 21015402 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1,2,17-trihydroxy-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12C(CCC3C1CCC1(C)C3CCC1(C)O)CC(=O)C(O)C2O |
| InChI | InChI=1S/C20H32O4/c1-18-8-6-14-12(13(18)7-9-19(18,2)24)5-4-11-10-15(21)16(22)17(23)20(11,14)3/h11-14,16-17,22-24H,4-10H2,1-3H3 |
| InChIKey | FDWQNDKMIZAKJK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |