C21H31ClO — CID 99566153
(5S,8R,9S,10S,13S,14S,17S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 99566153) has the molecular formula C21H31ClO and a molecular weight of 334.93 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S,17S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (5S,8R,9S,10S,13S,14S,17S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 99566153 |
| Molecular Formula | C21H31ClO |
| Molecular Weight | 334.93 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S,17S)-17-(2-chloroethynyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CCCC[C@H]1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C#CCl |
| InChI | InChI=1S/C21H31ClO/c1-19-10-4-3-5-15(19)6-7-16-17(19)8-11-20(2)18(16)9-12-21(20,23)13-14-22/h15-18,23H,3-12H2,1-2H3/t15-,16+,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | WJYFACPYOCRQPX-GCOKGBOCSA-N |
| XLogP | 5.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.93 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|