C21H36N2O — CID 129449305
(2R,5R,8R,9S,10S,13S,14S,17S)-3-hydrazinylidene-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 129449305) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is (2R,5R,8R,9S,10S,13S,14S,17S)-3-hydrazinylidene-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (2R,5R,8R,9S,10S,13S,14S,17S)-3-hydrazinylidene-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 129449305 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | (2R,5R,8R,9S,10S,13S,14S,17S)-3-hydrazinylidene-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@@H]1C[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CC[C@]2(C)O)CC1=NN |
| InChI | InChI=1S/C21H36N2O/c1-13-12-19(2)14(11-18(13)23-22)5-6-15-16(19)7-9-20(3)17(15)8-10-21(20,4)24/h13-17,24H,5-12,22H2,1-4H3/t13-,14-,15-,16+,17+,19+,20+,21+/m1/s1 |
| InChIKey | BQTJGNTXJNEPFQ-FAIYVORSSA-N |
| XLogP | 4.34 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|