C20H34O3 — CID 156721625
(10S,13S)-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3,17-triol (PubChem CID 156721625) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (10S,13S)-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3,17-triol.
| Compound Name | (10S,13S)-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3,17-triol |
|---|---|
| PubChem CID | 156721625 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (10S,13S)-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3,17-triol |
| SMILES | CC1(O)CCC2C3CCC4CC(O)(O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C20H34O3/c1-17-10-11-20(22,23)12-13(17)4-5-14-15(17)6-8-18(2)16(14)7-9-19(18,3)21/h13-16,21-23H,4-12H2,1-3H3/t13?,14?,15?,16?,17-,18-,19?/m0/s1 |
| InChIKey | WKNHYODEAPSVFW-AVGKFFPGSA-N |
| XLogP | 3.46 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|